C31H42N6O5 — CID 162405861
dimethyl 14-oxo-3,4,5,23,24,25-hexazatetracyclo[25.2.2.13,6.122,25]tritriaconta-1(29),4,6(33),22(32),23,27,30-heptaene-28,30-dicarboxylate (PubChem CID 162405861) has the molecular formula C31H42N6O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is dimethyl 14-oxo-3,4,5,23,24,25-hexazatetracyclo[25.2.2.13,6.122,25]tritriaconta-1(29),4,6(33),22(32),23,27,30-heptaene-28,30-dicarboxylate.
| Compound Name | dimethyl 14-oxo-3,4,5,23,24,25-hexazatetracyclo[25.2.2.13,6.122,25]tritriaconta-1(29),4,6(33),22(32),23,27,30-heptaene-28,30-dicarboxylate |
|---|---|
| PubChem CID | 162405861 |
| Molecular Formula | C31H42N6O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | dimethyl 14-oxo-3,4,5,23,24,25-hexazatetracyclo[25.2.2.13,6.122,25]tritriaconta-1(29),4,6(33),22(32),23,27,30-heptaene-28,30-dicarboxylate |
| SMILES | COC(=O)c1cc2c(C(=O)OC)cc1Cn1cc(nn1)CCCCCCCC(=O)CCCCCCCc1cn(nn1)C2 |
| InChI | InChI=1S/C31H42N6O5/c1-41-30(39)28-17-24-20-37-22-26(33-35-37)14-10-6-4-8-12-16-27(38)15-11-7-3-5-9-13-25-21-36(34-32-25)19-23(28)18-29(24)31(40)42-2/h17-18,21-22H,3-16,19-20H2,1-2H3 |
| InChIKey | GAYDBIOBHBZBGP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 131.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |