About 2,2-dimethyl-1,3-benzodithiole-5,6-diol
2,2-dimethyl-1,3-benzodithiole-5,6-diol (PubChem CID 162406024) has the molecular formula C9H10O2S2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-benzodithiole-5,6-diol.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,3-benzodithiole-5,6-diol |
| PubChem CID | 162406024 |
| Molecular Formula | C9H10O2S2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2,2-dimethyl-1,3-benzodithiole-5,6-diol |
| SMILES | CC1(C)Sc2cc(O)c(O)cc2S1 |
| InChI | InChI=1S/C9H10O2S2/c1-9(2)12-7-3-5(10)6(11)4-8(7)13-9/h3-4,10-11H,1-2H3 |
| InChIKey | OCFAISRWOQCTIQ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-1,3-benzodithiole-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,3-benzodithiole-5,6-diol?
The IUPAC name of 2,2-dimethyl-1,3-benzodithiole-5,6-diol (CID 162406024) is 2,2-dimethyl-1,3-benzodithiole-5,6-diol.
What is the SMILES notation for 2,2-dimethyl-1,3-benzodithiole-5,6-diol?
The canonical SMILES for 2,2-dimethyl-1,3-benzodithiole-5,6-diol is CC1(C)Sc2cc(O)c(O)cc2S1.
What is the InChIKey of 2,2-dimethyl-1,3-benzodithiole-5,6-diol?
The InChIKey is OCFAISRWOQCTIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S2/c1-9(2)12-7-3-5(10)6(11)4-8(7)13-9/h3-4,10-11H,1-2H3.
What are the key properties of 2,2-dimethyl-1,3-benzodithiole-5,6-diol?
2,2-dimethyl-1,3-benzodithiole-5,6-diol has a molecular weight of 214.31 g/mol, XLogP of 3.03, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,3-benzodithiole-5,6-diol is sourced from PubChem (CID 162406024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).