About 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine
7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine (PubChem CID 162406212) has the molecular formula C25H27BrN2
and a molecular weight of 435.41 g/mol. Its IUPAC name is 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine.
Molecular Properties
| Compound Name | 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine |
| PubChem CID | 162406212 |
| Molecular Formula | C25H27BrN2 |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine |
| SMILES | CC(C)(C)C1=Nc2ccc(Br)cc2C(=C2CCCCC2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C25H27BrN2/c1-25(2,3)24-27-21-15-14-19(26)16-20(21)22(17-10-6-4-7-11-17)23(28-24)18-12-8-5-9-13-18/h5,8-9,12-16H,4,6-7,10-11H2,1-3H3 |
| InChIKey | WWENCKNYZZQEME-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine?
The IUPAC name of 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine (CID 162406212) is 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine.
What is the SMILES notation for 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine?
The canonical SMILES for 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine is CC(C)(C)C1=Nc2ccc(Br)cc2C(=C2CCCCC2)C(c2ccccc2)=N1.
What is the InChIKey of 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine?
The InChIKey is WWENCKNYZZQEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27BrN2/c1-25(2,3)24-27-21-15-14-19(26)16-20(21)22(17-10-6-4-7-11-17)23(28-24)18-12-8-5-9-13-18/h5,8-9,12-16H,4,6-7,10-11H2,1-3H3.
What are the key properties of 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine?
7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine has a molecular weight of 435.41 g/mol, XLogP of 7.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2-tert-butyl-5-cyclohexylidene-4-phenyl-1,3-benzodiazepine is sourced from PubChem (CID 162406212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).