C18H32O4Si — CID 162406240
(3aS,6S,6aR,9R,9aR,9bS)-6-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3a,4,5,6,6a,7,8,9,9a,9b-decahydro-3H-azuleno[4,5-b]furan-2-one (PubChem CID 162406240) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (3aS,6S,6aR,9R,9aR,9bS)-6-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3a,4,5,6,6a,7,8,9,9a,9b-decahydro-3H-azuleno[4,5-b]furan-2-one.
| Compound Name | (3aS,6S,6aR,9R,9aR,9bS)-6-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3a,4,5,6,6a,7,8,9,9a,9b-decahydro-3H-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 162406240 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (3aS,6S,6aR,9R,9aR,9bS)-6-[tert-butyl(dimethyl)silyl]oxy-9-hydroxy-3a,4,5,6,6a,7,8,9,9a,9b-decahydro-3H-azuleno[4,5-b]furan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2CC(=O)O[C@@H]2[C@@H]2[C@H]1CC[C@H]2O |
| InChI | InChI=1S/C18H32O4Si/c1-18(2,3)23(4,5)22-14-9-6-11-10-15(20)21-17(11)16-12(14)7-8-13(16)19/h11-14,16-17,19H,6-10H2,1-5H3/t11-,12-,13+,14-,16+,17-/m0/s1 |
| InChIKey | BOMJDJFQOUXKDQ-TTZWVMEKSA-N |
| XLogP | 3.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|