About tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane
tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane (PubChem CID 162406243) has the molecular formula C18H30OSi
and a molecular weight of 290.52 g/mol. Its IUPAC name is tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane |
| PubChem CID | 162406243 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane |
| SMILES | C#CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C#C)CCC=C |
| InChI | InChI=1S/C18H30OSi/c1-9-12-14-16(11-3)17(15-13-10-2)19-20(7,8)18(4,5)6/h2-3,9,16-17H,1,12-15H2,4-8H3/t16-,17-/m0/s1 |
| InChIKey | BFVSRQVJMOFJBU-IRXDYDNUSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane?
The IUPAC name of tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane (CID 162406243) is tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane.
What is the SMILES notation for tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane?
The canonical SMILES for tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane is C#CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C#C)CCC=C.
What is the InChIKey of tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane?
The InChIKey is BFVSRQVJMOFJBU-IRXDYDNUSA-N. The full InChI is InChI=1S/C18H30OSi/c1-9-12-14-16(11-3)17(15-13-10-2)19-20(7,8)18(4,5)6/h2-3,9,16-17H,1,12-15H2,4-8H3/t16-,17-/m0/s1.
What are the key properties of tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane?
tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane has a molecular weight of 290.52 g/mol, XLogP of 5.01, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[(5S,6R)-6-ethynyldec-9-en-1-yn-5-yl]oxy-dimethylsilane is sourced from PubChem (CID 162406243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).