C14H17F3O8S — CID 162406279
[4-[(2R,3S,4R,5S)-5-(dimethoxymethyl)-3,4-dihydroxyoxolan-2-yl]phenyl] trifluoromethanesulfonate (PubChem CID 162406279) has the molecular formula C14H17F3O8S and a molecular weight of 402.34 g/mol. Its IUPAC name is [4-[(2R,3S,4R,5S)-5-(dimethoxymethyl)-3,4-dihydroxyoxolan-2-yl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(2R,3S,4R,5S)-5-(dimethoxymethyl)-3,4-dihydroxyoxolan-2-yl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 162406279 |
| Molecular Formula | C14H17F3O8S |
| Molecular Weight | 402.34 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | [4-[(2R,3S,4R,5S)-5-(dimethoxymethyl)-3,4-dihydroxyoxolan-2-yl]phenyl] trifluoromethanesulfonate |
| SMILES | COC(OC)[C@H]1O[C@H](c2ccc(OS(=O)(=O)C(F)(F)F)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H17F3O8S/c1-22-13(23-2)12-10(19)9(18)11(24-12)7-3-5-8(6-4-7)25-26(20,21)14(15,16)17/h3-6,9-13,18-19H,1-2H3/t9-,10+,11+,12-/m0/s1 |
| InChIKey | HRXGRKSKCWBPKP-QCNOEVLYSA-N |
| XLogP | 0.70 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|