C58H48F3NO3 — CID 162406327
5-(4-tert-butylphenyl)-4,9-bis(4-ethylphenyl)-6-(4-methoxyphenyl)-7-phenyl-8-[4-(trifluoromethyl)phenyl]benzo[f]isoindole-1,3-dione (PubChem CID 162406327) has the molecular formula C58H48F3NO3 and a molecular weight of 864.02 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4,9-bis(4-ethylphenyl)-6-(4-methoxyphenyl)-7-phenyl-8-[4-(trifluoromethyl)phenyl]benzo[f]isoindole-1,3-dione.
| Compound Name | 5-(4-tert-butylphenyl)-4,9-bis(4-ethylphenyl)-6-(4-methoxyphenyl)-7-phenyl-8-[4-(trifluoromethyl)phenyl]benzo[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 162406327 |
| Molecular Formula | C58H48F3NO3 |
| Molecular Weight | 864.02 g/mol |
| Exact Mass | 863.36 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4,9-bis(4-ethylphenyl)-6-(4-methoxyphenyl)-7-phenyl-8-[4-(trifluoromethyl)phenyl]benzo[f]isoindole-1,3-dione |
| SMILES | CCc1ccc(-c2c3c(c(-c4ccc(CC)cc4)c4c(-c5ccc(C(F)(F)F)cc5)c(-c5ccccc5)c(-c5ccc(OC)cc5)c(-c5ccc(C(C)(C)C)cc5)c24)C(=O)NC3=O)cc1 |
| InChI | InChI=1S/C58H48F3NO3/c1-7-34-14-18-37(19-15-34)49-51-47(40-24-30-43(31-25-40)58(59,60)61)45(36-12-10-9-11-13-36)46(41-26-32-44(65-6)33-27-41)48(39-22-28-42(29-23-39)57(3,4)5)52(51)50(38-20-16-35(8-2)17-21-38)54-53(49)55(63)62-56(54)64/h9-33H,7-8H2,1-6H3,(H,62,63,64) |
| InChIKey | HIFZVFQHOKPMBL-UHFFFAOYSA-N |
| XLogP | 15.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.02 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|