C15H26O5 — CID 162406350
methyl (E,4S,5S,6S,8R)-5-(methoxymethoxy)-4,6,8-trimethyl-9-oxonon-2-enoate (PubChem CID 162406350) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl (E,4S,5S,6S,8R)-5-(methoxymethoxy)-4,6,8-trimethyl-9-oxonon-2-enoate.
| Compound Name | methyl (E,4S,5S,6S,8R)-5-(methoxymethoxy)-4,6,8-trimethyl-9-oxonon-2-enoate |
|---|---|
| PubChem CID | 162406350 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | methyl (E,4S,5S,6S,8R)-5-(methoxymethoxy)-4,6,8-trimethyl-9-oxonon-2-enoate |
| SMILES | COCO[C@H]([C@@H](C)/C=C/C(=O)OC)[C@@H](C)C[C@@H](C)C=O |
| InChI | InChI=1S/C15H26O5/c1-11(9-16)8-13(3)15(20-10-18-4)12(2)6-7-14(17)19-5/h6-7,9,11-13,15H,8,10H2,1-5H3/b7-6+/t11-,12+,13+,15-/m1/s1 |
| InChIKey | HSUCUDVJMMHELJ-HOBKBVDKSA-N |
| XLogP | 2.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|