C18H36O4Si — CID 162406361
(1R,3aR,4S,7S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-7-(2-hydroxyethyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol (PubChem CID 162406361) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (1R,3aR,4S,7S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-7-(2-hydroxyethyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol.
| Compound Name | (1R,3aR,4S,7S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-7-(2-hydroxyethyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
|---|---|
| PubChem CID | 162406361 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (1R,3aR,4S,7S,8S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-7-(2-hydroxyethyl)-1,2,3,3a,4,5,6,7,8,8a-decahydroazulene-1,8-diol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@@H](CCO)[C@H](O)[C@@H]2[C@H]1CC[C@H]2O |
| InChI | InChI=1S/C18H36O4Si/c1-18(2,3)23(4,5)22-15-9-6-12(10-11-19)17(21)16-13(15)7-8-14(16)20/h12-17,19-21H,6-11H2,1-5H3/t12-,13-,14+,15-,16+,17-/m0/s1 |
| InChIKey | RUKVSTPZRJCRIF-NYXISSTPSA-N |
| XLogP | 2.92 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|