C20H24FNO2Si — CID 162406451
3-[(1R,2S)-2-fluoro-2-phenyl-1-(4-trimethylsilylphenyl)ethyl]-1,3-oxazolidin-2-one (PubChem CID 162406451) has the molecular formula C20H24FNO2Si and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-[(1R,2S)-2-fluoro-2-phenyl-1-(4-trimethylsilylphenyl)ethyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(1R,2S)-2-fluoro-2-phenyl-1-(4-trimethylsilylphenyl)ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162406451 |
| Molecular Formula | C20H24FNO2Si |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 3-[(1R,2S)-2-fluoro-2-phenyl-1-(4-trimethylsilylphenyl)ethyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)c1ccc([C@H]([C@@H](F)c2ccccc2)N2CCOC2=O)cc1 |
| InChI | InChI=1S/C20H24FNO2Si/c1-25(2,3)17-11-9-16(10-12-17)19(22-13-14-24-20(22)23)18(21)15-7-5-4-6-8-15/h4-12,18-19H,13-14H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | LZEMSHMPPSGOPJ-RBUKOAKNSA-N |
| XLogP | 4.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|