C18H28O4S — CID 162406464
tert-butyl (2R)-4,4-dimethyl-2-(4-methylsulfonylphenyl)pentanoate (PubChem CID 162406464) has the molecular formula C18H28O4S and a molecular weight of 340.49 g/mol. Its IUPAC name is tert-butyl (2R)-4,4-dimethyl-2-(4-methylsulfonylphenyl)pentanoate.
| Compound Name | tert-butyl (2R)-4,4-dimethyl-2-(4-methylsulfonylphenyl)pentanoate |
|---|---|
| PubChem CID | 162406464 |
| Molecular Formula | C18H28O4S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | tert-butyl (2R)-4,4-dimethyl-2-(4-methylsulfonylphenyl)pentanoate |
| SMILES | CC(C)(C)C[C@@H](C(=O)OC(C)(C)C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H28O4S/c1-17(2,3)12-15(16(19)22-18(4,5)6)13-8-10-14(11-9-13)23(7,20)21/h8-11,15H,12H2,1-7H3/t15-/m1/s1 |
| InChIKey | FCXPCFTYUSKKAP-OAHLLOKOSA-N |
| XLogP | 3.95 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |