About 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole
5-(4-azido-3-fluorophenyl)-1,3-benzodioxole (PubChem CID 162406539) has the molecular formula C13H8FN3O2
and a molecular weight of 257.22 g/mol. Its IUPAC name is 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole |
| PubChem CID | 162406539 |
| Molecular Formula | C13H8FN3O2 |
| Molecular Weight | 257.22 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole |
| SMILES | [N-]=[N+]=Nc1ccc(-c2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C13H8FN3O2/c14-10-5-8(1-3-11(10)16-17-15)9-2-4-12-13(6-9)19-7-18-12/h1-6H,7H2 |
| InChIKey | FTOKMKZRRNUXDE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole?
The IUPAC name of 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole (CID 162406539) is 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole.
What is the SMILES notation for 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole?
The canonical SMILES for 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole is [N-]=[N+]=Nc1ccc(-c2ccc3c(c2)OCO3)cc1F.
What is the InChIKey of 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole?
The InChIKey is FTOKMKZRRNUXDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8FN3O2/c14-10-5-8(1-3-11(10)16-17-15)9-2-4-12-13(6-9)19-7-18-12/h1-6H,7H2.
What are the key properties of 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole?
5-(4-azido-3-fluorophenyl)-1,3-benzodioxole has a molecular weight of 257.22 g/mol, XLogP of 4.16, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-azido-3-fluorophenyl)-1,3-benzodioxole is sourced from PubChem (CID 162406539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).