About (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate
(3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate (PubChem CID 162406641) has the molecular formula C18H16O3S
and a molecular weight of 312.39 g/mol. Its IUPAC name is (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate.
Molecular Properties
| Compound Name | (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate |
| PubChem CID | 162406641 |
| Molecular Formula | C18H16O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate |
| SMILES | C#Cc1cccc(OS(=O)(=O)/C=C/c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C18H16O3S/c1-4-16-6-5-7-18(13-16)21-22(19,20)11-10-17-9-8-14(2)12-15(17)3/h1,5-13H,2-3H3/b11-10+ |
| InChIKey | MYJKSXKDTCSYGP-ZHACJKMWSA-N |
| XLogP | 3.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate?
The IUPAC name of (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate (CID 162406641) is (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate.
What is the SMILES notation for (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate?
The canonical SMILES for (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate is C#Cc1cccc(OS(=O)(=O)/C=C/c2ccc(C)cc2C)c1.
What is the InChIKey of (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate?
The InChIKey is MYJKSXKDTCSYGP-ZHACJKMWSA-N. The full InChI is InChI=1S/C18H16O3S/c1-4-16-6-5-7-18(13-16)21-22(19,20)11-10-17-9-8-14(2)12-15(17)3/h1,5-13H,2-3H3/b11-10+.
What are the key properties of (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate?
(3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate has a molecular weight of 312.39 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethynylphenyl) (E)-2-(2,4-dimethylphenyl)ethenesulfonate is sourced from PubChem (CID 162406641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).