About CID 162407441
CID 162407441 (PubChem CID 162407441) has the molecular formula C18H30O7S
and a molecular weight of 390.50 g/mol.
Molecular Properties
| Compound Name | CID 162407441 |
| PubChem CID | 162407441 |
| Molecular Formula | C18H30O7S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | — |
| SMILES | CCS[C@@H]1O[C@H](CO)[C@H](O)[C@@H]2O[C@]3(CCCCO3)[C@@]3(CCCCO3)O[C@H]21 |
| InChI | InChI=1S/C18H30O7S/c1-2-26-16-15-14(13(20)12(11-19)23-16)24-17(7-3-5-9-21-17)18(25-15)8-4-6-10-22-18/h12-16,19-20H,2-11H2,1H3/t12-,13+,14+,15-,16+,17-,18-/m1/s1 |
| InChIKey | PQJVWIPUQZYOGF-NYIQUJALSA-N |
| XLogP | 1.40 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze CID 162407441 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162407441?
The IUPAC name of CID 162407441 (CID 162407441) is not available.
What is the SMILES notation for CID 162407441?
The canonical SMILES for CID 162407441 is CCS[C@@H]1O[C@H](CO)[C@H](O)[C@@H]2O[C@]3(CCCCO3)[C@@]3(CCCCO3)O[C@H]21.
What is the InChIKey of CID 162407441?
The InChIKey is PQJVWIPUQZYOGF-NYIQUJALSA-N. The full InChI is InChI=1S/C18H30O7S/c1-2-26-16-15-14(13(20)12(11-19)23-16)24-17(7-3-5-9-21-17)18(25-15)8-4-6-10-22-18/h12-16,19-20H,2-11H2,1H3/t12-,13+,14+,15-,16+,17-,18-/m1/s1.
What are the key properties of CID 162407441?
CID 162407441 has a molecular weight of 390.50 g/mol, XLogP of 1.40, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162407441 is sourced from PubChem (CID 162407441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).