C10H8F12O3 — CID 162407680
2-[1,1,3,3,3-pentafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]-1,4-dioxane (PubChem CID 162407680) has the molecular formula C10H8F12O3 and a molecular weight of 404.15 g/mol. Its IUPAC name is 2-[1,1,3,3,3-pentafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]-1,4-dioxane.
| Compound Name | 2-[1,1,3,3,3-pentafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]-1,4-dioxane |
|---|---|
| PubChem CID | 162407680 |
| Molecular Formula | C10H8F12O3 |
| Molecular Weight | 404.15 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[1,1,3,3,3-pentafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propyl]-1,4-dioxane |
| SMILES | FC(F)(F)C(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C1COCCO1 |
| InChI | InChI=1S/C10H8F12O3/c11-6(12,4-3-23-1-2-24-4)5(7(13,14)15)25-10(21,22)8(16,17)9(18,19)20/h4-5H,1-3H2 |
| InChIKey | PYPUNJLPZWRFIS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.15 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|