C18H17NO3 — CID 162407697
3-[1-[(2S,4aS,8aR)-4a-methyl-7-oxo-2,3,8,8a-tetrahydro-1,4-benzodioxin-2-yl]ethenyl]benzonitrile (PubChem CID 162407697) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[1-[(2S,4aS,8aR)-4a-methyl-7-oxo-2,3,8,8a-tetrahydro-1,4-benzodioxin-2-yl]ethenyl]benzonitrile.
| Compound Name | 3-[1-[(2S,4aS,8aR)-4a-methyl-7-oxo-2,3,8,8a-tetrahydro-1,4-benzodioxin-2-yl]ethenyl]benzonitrile |
|---|---|
| PubChem CID | 162407697 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-[1-[(2S,4aS,8aR)-4a-methyl-7-oxo-2,3,8,8a-tetrahydro-1,4-benzodioxin-2-yl]ethenyl]benzonitrile |
| SMILES | C=C(c1cccc(C#N)c1)[C@H]1CO[C@@]2(C)C=CC(=O)C[C@H]2O1 |
| InChI | InChI=1S/C18H17NO3/c1-12(14-5-3-4-13(8-14)10-19)16-11-21-18(2)7-6-15(20)9-17(18)22-16/h3-8,16-17H,1,9,11H2,2H3/t16-,17-,18+/m1/s1 |
| InChIKey | UCDQKFJUQZNUHK-KURKYZTESA-N |
| XLogP | 2.64 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |