C19H24F3NO3 — CID 162407879
benzyl 4,4-dimethyl-2-methylidene-7-[(2,2,2-trifluoroacetyl)amino]heptanoate (PubChem CID 162407879) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is benzyl 4,4-dimethyl-2-methylidene-7-[(2,2,2-trifluoroacetyl)amino]heptanoate.
| Compound Name | benzyl 4,4-dimethyl-2-methylidene-7-[(2,2,2-trifluoroacetyl)amino]heptanoate |
|---|---|
| PubChem CID | 162407879 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | benzyl 4,4-dimethyl-2-methylidene-7-[(2,2,2-trifluoroacetyl)amino]heptanoate |
| SMILES | C=C(CC(C)(C)CCCNC(=O)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H24F3NO3/c1-14(16(24)26-13-15-8-5-4-6-9-15)12-18(2,3)10-7-11-23-17(25)19(20,21)22/h4-6,8-9H,1,7,10-13H2,2-3H3,(H,23,25) |
| InChIKey | WTHGVRBYHZCNAW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|