C10H7F6NS — CID 162407962
4-[(Z)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]sulfanylaniline (PubChem CID 162407962) has the molecular formula C10H7F6NS and a molecular weight of 287.23 g/mol. Its IUPAC name is 4-[(Z)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]sulfanylaniline.
| Compound Name | 4-[(Z)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]sulfanylaniline |
|---|---|
| PubChem CID | 162407962 |
| Molecular Formula | C10H7F6NS |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 4-[(Z)-1,1,1,4,4,4-hexafluorobut-2-en-2-yl]sulfanylaniline |
| SMILES | Nc1ccc(S/C(=C\C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F6NS/c11-9(12,13)5-8(10(14,15)16)18-7-3-1-6(17)2-4-7/h1-5H,17H2/b8-5- |
| InChIKey | CPQKWVNMHPDVNI-YVMONPNESA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|