C17H31NO3 — CID 162408096
ethyl 7-(2,2-dimethylpropanoylamino)-4,4-dimethyl-2-methylideneheptanoate (PubChem CID 162408096) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is ethyl 7-(2,2-dimethylpropanoylamino)-4,4-dimethyl-2-methylideneheptanoate.
| Compound Name | ethyl 7-(2,2-dimethylpropanoylamino)-4,4-dimethyl-2-methylideneheptanoate |
|---|---|
| PubChem CID | 162408096 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | ethyl 7-(2,2-dimethylpropanoylamino)-4,4-dimethyl-2-methylideneheptanoate |
| SMILES | C=C(CC(C)(C)CCCNC(=O)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C17H31NO3/c1-8-21-14(19)13(2)12-17(6,7)10-9-11-18-15(20)16(3,4)5/h2,8-12H2,1,3-7H3,(H,18,20) |
| InChIKey | GETPGYKIIXCJEA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|