C16H28O7S — CID 162408107
(3aS,4R,6R,7R,7aS)-4-ethylsulfanyl-6-(hydroxymethyl)-2',2'-dimethoxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol (PubChem CID 162408107) has the molecular formula C16H28O7S and a molecular weight of 364.46 g/mol. Its IUPAC name is (3aS,4R,6R,7R,7aS)-4-ethylsulfanyl-6-(hydroxymethyl)-2',2'-dimethoxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol.
| Compound Name | (3aS,4R,6R,7R,7aS)-4-ethylsulfanyl-6-(hydroxymethyl)-2',2'-dimethoxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol |
|---|---|
| PubChem CID | 162408107 |
| Molecular Formula | C16H28O7S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3aS,4R,6R,7R,7aS)-4-ethylsulfanyl-6-(hydroxymethyl)-2',2'-dimethoxyspiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,1'-cyclohexane]-7-ol |
| SMILES | CCS[C@H]1O[C@H](CO)[C@@H](O)[C@@H]2OC3(CCCCC3(OC)OC)O[C@@H]21 |
| InChI | InChI=1S/C16H28O7S/c1-4-24-14-13-12(11(18)10(9-17)21-14)22-16(23-13)8-6-5-7-15(16,19-2)20-3/h10-14,17-18H,4-9H2,1-3H3/t10-,11-,12+,13+,14-,16?/m1/s1 |
| InChIKey | ZZQIXPLUYBYBQY-CMZYBMBOSA-N |
| XLogP | 0.86 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|