C14H26O2 — CID 162408125
(3S,4aR,8aR)-3-hexyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine (PubChem CID 162408125) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (3S,4aR,8aR)-3-hexyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine.
| Compound Name | (3S,4aR,8aR)-3-hexyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine |
|---|---|
| PubChem CID | 162408125 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (3S,4aR,8aR)-3-hexyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxine |
| SMILES | CCCCCC[C@H]1CO[C@@H]2CCCC[C@H]2O1 |
| InChI | InChI=1S/C14H26O2/c1-2-3-4-5-8-12-11-15-13-9-6-7-10-14(13)16-12/h12-14H,2-11H2,1H3/t12-,13+,14+/m0/s1 |
| InChIKey | XJFDHQCBVBUZAH-BFHYXJOUSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|