About [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride
[(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride (PubChem CID 162408134) has the molecular formula C6H14ClNO2
and a molecular weight of 167.64 g/mol. Its IUPAC name is [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride.
Molecular Properties
| Compound Name | [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride |
| PubChem CID | 162408134 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride |
| SMILES | C[NH2+]C[C@@H]1COCCO1.[Cl-] |
| InChI | InChI=1S/C6H13NO2.ClH/c1-7-4-6-5-8-2-3-9-6;/h6-7H,2-5H2,1H3;1H/t6-;/m1./s1 |
| InChIKey | MUZNZRLDNIWRKI-FYZOBXCZSA-N |
| XLogP | -4.40 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride?
The IUPAC name of [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride (CID 162408134) is [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride.
What is the SMILES notation for [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride?
The canonical SMILES for [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride is C[NH2+]C[C@@H]1COCCO1.[Cl-].
What is the InChIKey of [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride?
The InChIKey is MUZNZRLDNIWRKI-FYZOBXCZSA-N. The full InChI is InChI=1S/C6H13NO2.ClH/c1-7-4-6-5-8-2-3-9-6;/h6-7H,2-5H2,1H3;1H/t6-;/m1./s1.
What are the key properties of [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride?
[(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride has a molecular weight of 167.64 g/mol, XLogP of -4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1,4-dioxan-2-yl]methyl-methylazanium chloride is sourced from PubChem (CID 162408134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).