About N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine
N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine (PubChem CID 162408251) has the molecular formula C9H20N4
and a molecular weight of 184.29 g/mol. Its IUPAC name is N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine |
| PubChem CID | 162408251 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine |
| SMILES | C/C(=C/C(C)=N/CCN)NCCN |
| InChI | InChI=1S/C9H20N4/c1-8(12-5-3-10)7-9(2)13-6-4-11/h7,12H,3-6,10-11H2,1-2H3/b8-7-,13-9+ |
| InChIKey | VFGRMCKEWYOLCK-XTYDYKDCSA-N |
| XLogP | -0.14 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine?
The IUPAC name of N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine (CID 162408251) is N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine is C/C(=C/C(C)=N/CCN)NCCN.
What is the InChIKey of N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine?
The InChIKey is VFGRMCKEWYOLCK-XTYDYKDCSA-N. The full InChI is InChI=1S/C9H20N4/c1-8(12-5-3-10)7-9(2)13-6-4-11/h7,12H,3-6,10-11H2,1-2H3/b8-7-,13-9+.
What are the key properties of N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine?
N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine has a molecular weight of 184.29 g/mol, XLogP of -0.14, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-4-(2-aminoethylimino)pent-2-en-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 162408251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).