About 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline
6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline (PubChem CID 162408579) has the molecular formula C22H13F3N2
and a molecular weight of 362.35 g/mol. Its IUPAC name is 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline |
| PubChem CID | 162408579 |
| Molecular Formula | C22H13F3N2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline |
| SMILES | FC(F)(F)c1ccc2c(c1)nc(-c1ccccc1)n1c3ccccc3cc21 |
| InChI | InChI=1S/C22H13F3N2/c23-22(24,25)16-10-11-17-18(13-16)26-21(14-6-2-1-3-7-14)27-19-9-5-4-8-15(19)12-20(17)27/h1-13H |
| InChIKey | RGQCHYZAMGPCRP-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline?
The IUPAC name of 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline (CID 162408579) is 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline.
What is the SMILES notation for 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline?
The canonical SMILES for 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline is FC(F)(F)c1ccc2c(c1)nc(-c1ccccc1)n1c3ccccc3cc21.
What is the InChIKey of 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline?
The InChIKey is RGQCHYZAMGPCRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H13F3N2/c23-22(24,25)16-10-11-17-18(13-16)26-21(14-6-2-1-3-7-14)27-19-9-5-4-8-15(19)12-20(17)27/h1-13H.
What are the key properties of 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline?
6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline has a molecular weight of 362.35 g/mol, XLogP of 6.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-3-(trifluoromethyl)indolo[1,2-c]quinazoline is sourced from PubChem (CID 162408579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).