C8H14O3 — CID 162408582
[(2S)-2-prop-2-enyl-1,4-dioxan-2-yl]methanol (PubChem CID 162408582) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is [(2S)-2-prop-2-enyl-1,4-dioxan-2-yl]methanol.
| Compound Name | [(2S)-2-prop-2-enyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 162408582 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | [(2S)-2-prop-2-enyl-1,4-dioxan-2-yl]methanol |
| SMILES | C=CC[C@]1(CO)COCCO1 |
| InChI | InChI=1S/C8H14O3/c1-2-3-8(6-9)7-10-4-5-11-8/h2,9H,1,3-7H2/t8-/m0/s1 |
| InChIKey | OWULNOGIQBPWGG-QMMMGPOBSA-N |
| XLogP | 0.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|