hydrogen sulfate;piperidin-1-ium-4-one

C5H11NO5S — CID 162408812

IUPAChydrogen sulfate;piperidin-1-ium-4-one
SMILESO=C1CC[NH2+]CC1.O=S(=O)([O-])O
InChIInChI=1S/C5H9NO.H2O4S/c7-5-1-3-6-4-2-5;1-5(2,3)4/h6H,1-4H2;(H2,1,2,3,4)
InChIKeyPXCOQYVINBATNJ-UHFFFAOYSA-N
MW197.21 g/mol
LogP-2.08
Rot. Bonds

About hydrogen sulfate;piperidin-1-ium-4-one

hydrogen sulfate;piperidin-1-ium-4-one (PubChem CID 162408812) has the molecular formula C5H11NO5S and a molecular weight of 197.21 g/mol. Its IUPAC name is hydrogen sulfate;piperidin-1-ium-4-one.

Molecular Properties

Compound Namehydrogen sulfate;piperidin-1-ium-4-one
PubChem CID162408812
Molecular FormulaC5H11NO5S
Molecular Weight197.21 g/mol
Exact Mass197.04
IUPAC Namehydrogen sulfate;piperidin-1-ium-4-one
SMILESO=C1CC[NH2+]CC1.O=S(=O)([O-])O
InChIInChI=1S/C5H9NO.H2O4S/c7-5-1-3-6-4-2-5;1-5(2,3)4/h6H,1-4H2;(H2,1,2,3,4)
InChIKeyPXCOQYVINBATNJ-UHFFFAOYSA-N
XLogP-2.08
TPSA111.11 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.21
LogP ≤ 5-2.08
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}

Analyze hydrogen sulfate;piperidin-1-ium-4-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfate;piperidin-1-ium-4-one?
The IUPAC name of hydrogen sulfate;piperidin-1-ium-4-one (CID 162408812) is hydrogen sulfate;piperidin-1-ium-4-one.
What is the SMILES notation for hydrogen sulfate;piperidin-1-ium-4-one?
The canonical SMILES for hydrogen sulfate;piperidin-1-ium-4-one is O=C1CC[NH2+]CC1.O=S(=O)([O-])O.
What is the InChIKey of hydrogen sulfate;piperidin-1-ium-4-one?
The InChIKey is PXCOQYVINBATNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.H2O4S/c7-5-1-3-6-4-2-5;1-5(2,3)4/h6H,1-4H2;(H2,1,2,3,4).
What are the key properties of hydrogen sulfate;piperidin-1-ium-4-one?
hydrogen sulfate;piperidin-1-ium-4-one has a molecular weight of 197.21 g/mol, XLogP of -2.08, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfate;piperidin-1-ium-4-one is sourced from PubChem (CID 162408812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).