About S-phenyl 1,4-dioxane-2-carbothioate
S-phenyl 1,4-dioxane-2-carbothioate (PubChem CID 162408871) has the molecular formula C11H12O3S
and a molecular weight of 224.28 g/mol. Its IUPAC name is S-phenyl 1,4-dioxane-2-carbothioate.
Molecular Properties
| Compound Name | S-phenyl 1,4-dioxane-2-carbothioate |
| PubChem CID | 162408871 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | S-phenyl 1,4-dioxane-2-carbothioate |
| SMILES | O=C(Sc1ccccc1)C1COCCO1 |
| InChI | InChI=1S/C11H12O3S/c12-11(10-8-13-6-7-14-10)15-9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | YOEJXDDRKRNKMD-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl 1,4-dioxane-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl 1,4-dioxane-2-carbothioate?
The IUPAC name of S-phenyl 1,4-dioxane-2-carbothioate (CID 162408871) is S-phenyl 1,4-dioxane-2-carbothioate.
What is the SMILES notation for S-phenyl 1,4-dioxane-2-carbothioate?
The canonical SMILES for S-phenyl 1,4-dioxane-2-carbothioate is O=C(Sc1ccccc1)C1COCCO1.
What is the InChIKey of S-phenyl 1,4-dioxane-2-carbothioate?
The InChIKey is YOEJXDDRKRNKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3S/c12-11(10-8-13-6-7-14-10)15-9-4-2-1-3-5-9/h1-5,10H,6-8H2.
What are the key properties of S-phenyl 1,4-dioxane-2-carbothioate?
S-phenyl 1,4-dioxane-2-carbothioate has a molecular weight of 224.28 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl 1,4-dioxane-2-carbothioate is sourced from PubChem (CID 162408871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).