C20H24N2O2 — CID 162408939
2-[(2R,3R,4aR,8aR)-3-(2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenol (PubChem CID 162408939) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(2R,3R,4aR,8aR)-3-(2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenol.
| Compound Name | 2-[(2R,3R,4aR,8aR)-3-(2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenol |
|---|---|
| PubChem CID | 162408939 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 2-[(2R,3R,4aR,8aR)-3-(2-hydroxyphenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenol |
| SMILES | Oc1ccccc1[C@H]1N[C@@H]2CCCC[C@H]2N[C@@H]1c1ccccc1O |
| InChI | InChI=1S/C20H24N2O2/c23-17-11-5-1-7-13(17)19-20(14-8-2-6-12-18(14)24)22-16-10-4-3-9-15(16)21-19/h1-2,5-8,11-12,15-16,19-24H,3-4,9-10H2/t15-,16-,19-,20-/m1/s1 |
| InChIKey | UDGDEMDAUOLWRN-XNFNUYLZSA-N |
| XLogP | 3.38 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|