C21H31F3N2O5S — CID 162408956
ethyl 5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-8-[(2,2,2-trifluoroacetyl)amino]octanoate (PubChem CID 162408956) has the molecular formula C21H31F3N2O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is ethyl 5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-8-[(2,2,2-trifluoroacetyl)amino]octanoate.
| Compound Name | ethyl 5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-8-[(2,2,2-trifluoroacetyl)amino]octanoate |
|---|---|
| PubChem CID | 162408956 |
| Molecular Formula | C21H31F3N2O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | ethyl 5-[2-[(4-methylphenyl)sulfonylamino]ethyl]-8-[(2,2,2-trifluoroacetyl)amino]octanoate |
| SMILES | CCOC(=O)CCCC(CCCNC(=O)C(F)(F)F)CCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H31F3N2O5S/c1-3-31-19(27)8-4-6-17(7-5-14-25-20(28)21(22,23)24)13-15-26-32(29,30)18-11-9-16(2)10-12-18/h9-12,17,26H,3-8,13-15H2,1-2H3,(H,25,28) |
| InChIKey | HOHVRQAWAILIMU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|