About 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone
1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone (PubChem CID 162408968) has the molecular formula C15H15ClO3S2
and a molecular weight of 342.87 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone |
| PubChem CID | 162408968 |
| Molecular Formula | C15H15ClO3S2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone |
| SMILES | O=C(C(=C1SCCS1)C1COCCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClO3S2/c16-11-3-1-10(2-4-11)14(17)13(15-20-7-8-21-15)12-9-18-5-6-19-12/h1-4,12H,5-9H2 |
| InChIKey | UGMZZQMNRYZVRM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone?
The IUPAC name of 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone (CID 162408968) is 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone.
What is the SMILES notation for 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone?
The canonical SMILES for 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone is O=C(C(=C1SCCS1)C1COCCO1)c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone?
The InChIKey is UGMZZQMNRYZVRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClO3S2/c16-11-3-1-10(2-4-11)14(17)13(15-20-7-8-21-15)12-9-18-5-6-19-12/h1-4,12H,5-9H2.
What are the key properties of 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone?
1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone has a molecular weight of 342.87 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-2-(1,4-dioxan-2-yl)-2-(1,3-dithiolan-2-ylidene)ethanone is sourced from PubChem (CID 162408968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).