C41H32BrNO — CID 162408982
2-bromo-6,7,8,9-tetrakis(4-methylphenyl)pyrido[1,2-a]indole-10-carbaldehyde (PubChem CID 162408982) has the molecular formula C41H32BrNO and a molecular weight of 634.62 g/mol. Its IUPAC name is 2-bromo-6,7,8,9-tetrakis(4-methylphenyl)pyrido[1,2-a]indole-10-carbaldehyde.
| Compound Name | 2-bromo-6,7,8,9-tetrakis(4-methylphenyl)pyrido[1,2-a]indole-10-carbaldehyde |
|---|---|
| PubChem CID | 162408982 |
| Molecular Formula | C41H32BrNO |
| Molecular Weight | 634.62 g/mol |
| Exact Mass | 633.17 |
| IUPAC Name | 2-bromo-6,7,8,9-tetrakis(4-methylphenyl)pyrido[1,2-a]indole-10-carbaldehyde |
| SMILES | Cc1ccc(-c2c(-c3ccc(C)cc3)c(-c3ccc(C)cc3)n3c(c2-c2ccc(C)cc2)c(C=O)c2cc(Br)ccc23)cc1 |
| InChI | InChI=1S/C41H32BrNO/c1-25-5-13-29(14-6-25)37-38(30-15-7-26(2)8-16-30)40(32-19-11-28(4)12-20-32)43-36-22-21-33(42)23-34(36)35(24-44)41(43)39(37)31-17-9-27(3)10-18-31/h5-24H,1-4H3 |
| InChIKey | PLFNNEBOIDNUBX-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 21.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.62 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|