About 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide
4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide (PubChem CID 162409118) has the molecular formula C13H18F3NO3S
and a molecular weight of 325.35 g/mol. Its IUPAC name is 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide |
| PubChem CID | 162409118 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCC(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-10(13(14,15)16)4-3-9-17-21(18,19)12-7-5-11(20-2)6-8-12/h5-8,10,17H,3-4,9H2,1-2H3 |
| InChIKey | RKQWWENUTPXQMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide?
The IUPAC name of 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide (CID 162409118) is 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide.
What is the SMILES notation for 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide?
The canonical SMILES for 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide is COc1ccc(S(=O)(=O)NCCCC(C)C(F)(F)F)cc1.
What is the InChIKey of 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide?
The InChIKey is RKQWWENUTPXQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18F3NO3S/c1-10(13(14,15)16)4-3-9-17-21(18,19)12-7-5-11(20-2)6-8-12/h5-8,10,17H,3-4,9H2,1-2H3.
What are the key properties of 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide?
4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide has a molecular weight of 325.35 g/mol, XLogP of 2.95, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N-(5,5,5-trifluoro-4-methylpentyl)benzenesulfonamide is sourced from PubChem (CID 162409118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).