C13H12O4S — CID 162409126
1,4-dioxan-2-yl 1-benzothiophene-2-carboxylate (PubChem CID 162409126) has the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. Its IUPAC name is 1,4-dioxan-2-yl 1-benzothiophene-2-carboxylate.
| Compound Name | 1,4-dioxan-2-yl 1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 162409126 |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1,4-dioxan-2-yl 1-benzothiophene-2-carboxylate |
| SMILES | O=C(OC1COCCO1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C13H12O4S/c14-13(17-12-8-15-5-6-16-12)11-7-9-3-1-2-4-10(9)18-11/h1-4,7,12H,5-6,8H2 |
| InChIKey | JLMCHQYTATXOCY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |