C17H30F3NO — CID 162409361
N-(4,4-dimethyl-6-methylidenedodecyl)-2,2,2-trifluoroacetamide (PubChem CID 162409361) has the molecular formula C17H30F3NO and a molecular weight of 321.43 g/mol. Its IUPAC name is N-(4,4-dimethyl-6-methylidenedodecyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4,4-dimethyl-6-methylidenedodecyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 162409361 |
| Molecular Formula | C17H30F3NO |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | N-(4,4-dimethyl-6-methylidenedodecyl)-2,2,2-trifluoroacetamide |
| SMILES | C=C(CCCCCC)CC(C)(C)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H30F3NO/c1-5-6-7-8-10-14(2)13-16(3,4)11-9-12-21-15(22)17(18,19)20/h2,5-13H2,1,3-4H3,(H,21,22) |
| InChIKey | WGMOPJWRLYGZCR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|