About 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline
2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline (PubChem CID 162409387) has the molecular formula C18H13F3N2
and a molecular weight of 314.31 g/mol. Its IUPAC name is 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline.
Molecular Properties
| Compound Name | 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline |
| PubChem CID | 162409387 |
| Molecular Formula | C18H13F3N2 |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline |
| SMILES | Cc1ccc2nc(C(F)(F)F)n3c4ccccc4c(C)c3c2c1 |
| InChI | InChI=1S/C18H13F3N2/c1-10-7-8-14-13(9-10)16-11(2)12-5-3-4-6-15(12)23(16)17(22-14)18(19,20)21/h3-9H,1-2H3 |
| InChIKey | CLCBMPHGHMXVMT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline?
The IUPAC name of 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline (CID 162409387) is 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline.
What is the SMILES notation for 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline?
The canonical SMILES for 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline is Cc1ccc2nc(C(F)(F)F)n3c4ccccc4c(C)c3c2c1.
What is the InChIKey of 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline?
The InChIKey is CLCBMPHGHMXVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2/c1-10-7-8-14-13(9-10)16-11(2)12-5-3-4-6-15(12)23(16)17(22-14)18(19,20)21/h3-9H,1-2H3.
What are the key properties of 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline?
2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline has a molecular weight of 314.31 g/mol, XLogP of 5.28, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,12-dimethyl-6-(trifluoromethyl)indolo[1,2-c]quinazoline is sourced from PubChem (CID 162409387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).