C10H17F — CID 162409397
(3R,6S)-3-(2-fluoropropan-2-yl)-6-methylcyclohexene (PubChem CID 162409397) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is (3R,6S)-3-(2-fluoropropan-2-yl)-6-methylcyclohexene.
| Compound Name | (3R,6S)-3-(2-fluoropropan-2-yl)-6-methylcyclohexene |
|---|---|
| PubChem CID | 162409397 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (3R,6S)-3-(2-fluoropropan-2-yl)-6-methylcyclohexene |
| SMILES | C[C@@H]1C=C[C@H](C(C)(C)F)CC1 |
| InChI | InChI=1S/C10H17F/c1-8-4-6-9(7-5-8)10(2,3)11/h4,6,8-9H,5,7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | ZCWSBZSJQFQQQQ-BDAKNGLRSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|