About 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine
1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine (PubChem CID 162409563) has the molecular formula C14H11BFN
and a molecular weight of 223.06 g/mol. Its IUPAC name is 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine |
| PubChem CID | 162409563 |
| Molecular Formula | C14H11BFN |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine |
| SMILES | Fc1ccc(C2=CC=CN3C=CC=CB23)cc1 |
| InChI | InChI=1S/C14H11BFN/c16-13-7-5-12(6-8-13)14-4-3-11-17-10-2-1-9-15(14)17/h1-11H |
| InChIKey | KVDPGPPXKXSYEI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine?
The IUPAC name of 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine (CID 162409563) is 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine.
What is the SMILES notation for 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine?
The canonical SMILES for 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine is Fc1ccc(C2=CC=CN3C=CC=CB23)cc1.
What is the InChIKey of 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine?
The InChIKey is KVDPGPPXKXSYEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BFN/c16-13-7-5-12(6-8-13)14-4-3-11-17-10-2-1-9-15(14)17/h1-11H.
What are the key properties of 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine?
1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine has a molecular weight of 223.06 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)azaborinino[1,2-a]azaborinine is sourced from PubChem (CID 162409563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).