C13H15NO — CID 162409585
1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indole (PubChem CID 162409585) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indole.
| Compound Name | 1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indole |
|---|---|
| PubChem CID | 162409585 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indole |
| SMILES | COc1cccc2c1cc1n2CCCC1 |
| InChI | InChI=1S/C13H15NO/c1-15-13-7-4-6-12-11(13)9-10-5-2-3-8-14(10)12/h4,6-7,9H,2-3,5,8H2,1H3 |
| InChIKey | CBHAMVRNTQOLMY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |