C22H24BrF2IO6 — CID 162409766
dimethyl (4E)-4-[(4-bromophenyl)-iodomethylidene]-3-(3-ethoxy-2,2-difluoro-3-oxopropyl)-3-methylcyclopentane-1,1-dicarboxylate (PubChem CID 162409766) has the molecular formula C22H24BrF2IO6 and a molecular weight of 629.23 g/mol. Its IUPAC name is dimethyl (4E)-4-[(4-bromophenyl)-iodomethylidene]-3-(3-ethoxy-2,2-difluoro-3-oxopropyl)-3-methylcyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-4-[(4-bromophenyl)-iodomethylidene]-3-(3-ethoxy-2,2-difluoro-3-oxopropyl)-3-methylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 162409766 |
| Molecular Formula | C22H24BrF2IO6 |
| Molecular Weight | 629.23 g/mol |
| Exact Mass | 627.98 |
| IUPAC Name | dimethyl (4E)-4-[(4-bromophenyl)-iodomethylidene]-3-(3-ethoxy-2,2-difluoro-3-oxopropyl)-3-methylcyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C(F)(F)CC1(C)CC(C(=O)OC)(C(=O)OC)C/C1=C(\I)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24BrF2IO6/c1-5-32-19(29)22(24,25)12-20(2)11-21(17(27)30-3,18(28)31-4)10-15(20)16(26)13-6-8-14(23)9-7-13/h6-9H,5,10-12H2,1-4H3/b16-15+ |
| InChIKey | NVXSDNVINWJZLP-FOCLMDBBSA-N |
| XLogP | 5.32 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.23 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|