C22H35N11O7 — CID 162409773
2-[(8S,14S)-16-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-6,9,12,15-tetraoxo-1,7,10,13,16,19,20-heptazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid (PubChem CID 162409773) has the molecular formula C22H35N11O7 and a molecular weight of 565.59 g/mol. Its IUPAC name is 2-[(8S,14S)-16-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-6,9,12,15-tetraoxo-1,7,10,13,16,19,20-heptazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid.
| Compound Name | 2-[(8S,14S)-16-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-6,9,12,15-tetraoxo-1,7,10,13,16,19,20-heptazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid |
|---|---|
| PubChem CID | 162409773 |
| Molecular Formula | C22H35N11O7 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | 2-[(8S,14S)-16-(2-amino-2-oxoethyl)-8-[3-(diaminomethylideneamino)propyl]-6,9,12,15-tetraoxo-1,7,10,13,16,19,20-heptazabicyclo[16.2.1]henicosa-18(21),19-dien-14-yl]acetic acid |
| SMILES | NC(=O)CN1Cc2cn(nn2)CCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@@H](CC(=O)O)C1=O |
| InChI | InChI=1S/C22H35N11O7/c23-16(34)12-32-10-13-11-33(31-30-13)7-2-1-5-17(35)28-14(4-3-6-26-22(24)25)20(39)27-9-18(36)29-15(21(32)40)8-19(37)38/h11,14-15H,1-10,12H2,(H2,23,34)(H,27,39)(H,28,35)(H,29,36)(H,37,38)(H4,24,25,26)/t14-,15-/m0/s1 |
| InChIKey | UOMPPMQXLACFQA-GJZGRUSLSA-N |
| XLogP | -4.11 |
| TPSA | 283.11 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|