About N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate
N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate (PubChem CID 162410028) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate.
Molecular Properties
| Compound Name | N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate |
| PubChem CID | 162410028 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate |
| SMILES | [O-]/C(=N\c1c[n+](-c2ccccc2)no1)Nc1ccccc1 |
| InChI | InChI=1S/C15H12N4O2/c20-15(16-12-7-3-1-4-8-12)17-14-11-19(18-21-14)13-9-5-2-6-10-13/h1-11H,(H-,16,17,18,20) |
| InChIKey | XMGXARDYRUYFRP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate?
The IUPAC name of N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate (CID 162410028) is N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate.
What is the SMILES notation for N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate?
The canonical SMILES for N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate is [O-]/C(=N\c1c[n+](-c2ccccc2)no1)Nc1ccccc1.
What is the InChIKey of N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate?
The InChIKey is XMGXARDYRUYFRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2/c20-15(16-12-7-3-1-4-8-12)17-14-11-19(18-21-14)13-9-5-2-6-10-13/h1-11H,(H-,16,17,18,20).
What are the key properties of N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate?
N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate has a molecular weight of 280.29 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyl-N'-(3-phenyloxadiazol-3-ium-5-yl)carbamimidate is sourced from PubChem (CID 162410028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).