About benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc
benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc (PubChem CID 162410091) has the molecular formula C22H29N2OZn-
and a molecular weight of 402.88 g/mol. Its IUPAC name is benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc.
Molecular Properties
| Compound Name | benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc |
| PubChem CID | 162410091 |
| Molecular Formula | C22H29N2OZn- |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc |
| SMILES | C/C(=C/C(C)=N\Cc1ccccc1)[N-]Cc1ccccc1.CC(C)O.[Zn] |
| InChI | InChI=1S/C19H21N2.C3H8O.Zn/c1-16(20-14-18-9-5-3-6-10-18)13-17(2)21-15-19-11-7-4-8-12-19;1-3(2)4;/h3-13H,14-15H2,1-2H3;3-4H,1-2H3;/q-1;;/b16-13-,21-17-;; |
| InChIKey | FWRSJSXTBBHYLA-TVZGWBDISA-N |
| XLogP | 5.51 |
| TPSA | 46.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc?
The IUPAC name of benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc (CID 162410091) is benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc.
What is the SMILES notation for benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc?
The canonical SMILES for benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc is C/C(=C/C(C)=N\Cc1ccccc1)[N-]Cc1ccccc1.CC(C)O.[Zn].
What is the InChIKey of benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc?
The InChIKey is FWRSJSXTBBHYLA-TVZGWBDISA-N. The full InChI is InChI=1S/C19H21N2.C3H8O.Zn/c1-16(20-14-18-9-5-3-6-10-18)13-17(2)21-15-19-11-7-4-8-12-19;1-3(2)4;/h3-13H,14-15H2,1-2H3;3-4H,1-2H3;/q-1;;/b16-13-,21-17-;;.
What are the key properties of benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc?
benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc has a molecular weight of 402.88 g/mol, XLogP of 5.51, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(Z)-4-benzyliminopent-2-en-2-yl]azanide;propan-2-ol;zinc is sourced from PubChem (CID 162410091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).