About methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate
methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate (PubChem CID 162410101) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate |
| PubChem CID | 162410101 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(CC2C[C@H](C)CC[C@H]2C(C)C)CCC1 |
| InChI | InChI=1S/C17H30O2/c1-12(2)15-7-6-13(3)10-14(15)11-17(8-5-9-17)16(18)19-4/h12-15H,5-11H2,1-4H3/t13-,14?,15+/m1/s1 |
| InChIKey | AYTOWRFZPUGTAC-LOWNFYCTSA-N |
| XLogP | 4.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate?
The IUPAC name of methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate (CID 162410101) is methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate.
What is the SMILES notation for methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate?
The canonical SMILES for methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate is COC(=O)C1(CC2C[C@H](C)CC[C@H]2C(C)C)CCC1.
What is the InChIKey of methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate?
The InChIKey is AYTOWRFZPUGTAC-LOWNFYCTSA-N. The full InChI is InChI=1S/C17H30O2/c1-12(2)15-7-6-13(3)10-14(15)11-17(8-5-9-17)16(18)19-4/h12-15H,5-11H2,1-4H3/t13-,14?,15+/m1/s1.
What are the key properties of methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate?
methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate has a molecular weight of 266.42 g/mol, XLogP of 4.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]methyl]cyclobutane-1-carboxylate is sourced from PubChem (CID 162410101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).