About tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate
tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate (PubChem CID 162410225) has the molecular formula C18H27NO7S
and a molecular weight of 401.48 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate |
| PubChem CID | 162410225 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCCO[C@@H]2CN(C(=O)OC(C)(C)C)C[C@H]2O)cc1 |
| InChI | InChI=1S/C18H27NO7S/c1-13-5-7-14(8-6-13)27(22,23)25-10-9-24-16-12-19(11-15(16)20)17(21)26-18(2,3)4/h5-8,15-16,20H,9-12H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | YTIQDFFGPTXFKR-HZPDHXFCSA-N |
| XLogP | 1.70 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate (CID 162410225) is tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate is Cc1ccc(S(=O)(=O)OCCO[C@@H]2CN(C(=O)OC(C)(C)C)C[C@H]2O)cc1.
What is the InChIKey of tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate?
The InChIKey is YTIQDFFGPTXFKR-HZPDHXFCSA-N. The full InChI is InChI=1S/C18H27NO7S/c1-13-5-7-14(8-6-13)27(22,23)25-10-9-24-16-12-19(11-15(16)20)17(21)26-18(2,3)4/h5-8,15-16,20H,9-12H2,1-4H3/t15-,16-/m1/s1.
What are the key properties of tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate?
tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate has a molecular weight of 401.48 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R,4R)-3-hydroxy-4-[2-(4-methylphenyl)sulfonyloxyethoxy]pyrrolidine-1-carboxylate is sourced from PubChem (CID 162410225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).