C26H17FN4O2S — CID 162411029
3-[2-[2-(4-fluorophenyl)ethynyl]pyrimidin-4-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (PubChem CID 162411029) has the molecular formula C26H17FN4O2S and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-[2-[2-(4-fluorophenyl)ethynyl]pyrimidin-4-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine.
| Compound Name | 3-[2-[2-(4-fluorophenyl)ethynyl]pyrimidin-4-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 162411029 |
| Molecular Formula | C26H17FN4O2S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 3-[2-[2-(4-fluorophenyl)ethynyl]pyrimidin-4-yl]-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(-c3ccnc(C#Cc4ccc(F)cc4)n3)c3cccnc32)cc1 |
| InChI | InChI=1S/C26H17FN4O2S/c1-18-4-11-21(12-5-18)34(32,33)31-17-23(22-3-2-15-29-26(22)31)24-14-16-28-25(30-24)13-8-19-6-9-20(27)10-7-19/h2-7,9-12,14-17H,1H3 |
| InChIKey | WMXKQXQMWNNQTL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|