C17H26O4Si — CID 162411205
ethyl (1R,4S,5R,6S,12S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate (PubChem CID 162411205) has the molecular formula C17H26O4Si and a molecular weight of 322.48 g/mol. Its IUPAC name is ethyl (1R,4S,5R,6S,12S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate.
| Compound Name | ethyl (1R,4S,5R,6S,12S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate |
|---|---|
| PubChem CID | 162411205 |
| Molecular Formula | C17H26O4Si |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | ethyl (1R,4S,5R,6S,12S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)O[C@@H]3CCCC(=C[C@@H]1[Si](C)(C)C)[C@H]23 |
| InChI | InChI=1S/C17H26O4Si/c1-5-20-16(18)14-12(22(2,3)4)9-10-7-6-8-11-13(10)15(14)17(19)21-11/h9,11-15H,5-8H2,1-4H3/t11-,12+,13+,14-,15+/m1/s1 |
| InChIKey | LJOHZFUAHFGLFT-FQKPHLNHSA-N |
| XLogP | 3.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|