C20H26O4SSi — CID 162411361
(1R,4R,5S,6S,12S)-5-(benzenesulfonyl)-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one (PubChem CID 162411361) has the molecular formula C20H26O4SSi and a molecular weight of 390.58 g/mol. Its IUPAC name is (1R,4R,5S,6S,12S)-5-(benzenesulfonyl)-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one.
| Compound Name | (1R,4R,5S,6S,12S)-5-(benzenesulfonyl)-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one |
|---|---|
| PubChem CID | 162411361 |
| Molecular Formula | C20H26O4SSi |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | (1R,4R,5S,6S,12S)-5-(benzenesulfonyl)-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-en-3-one |
| SMILES | C[Si](C)(C)[C@H]1C=C2CCC[C@H]3OC(=O)[C@@H]([C@@H]23)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26O4SSi/c1-26(2,3)16-12-13-8-7-11-15-17(13)18(20(21)24-15)19(16)25(22,23)14-9-5-4-6-10-14/h4-6,9-10,12,15-19H,7-8,11H2,1-3H3/t15-,16+,17+,18+,19-/m1/s1 |
| InChIKey | LXBJNQIAESXXOY-HVMFNXBNSA-N |
| XLogP | 3.82 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|