C19H30O4Si — CID 162411362
ethyl (1R,4S,5R,6S,12S)-9,9-dimethyl-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate (PubChem CID 162411362) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is ethyl (1R,4S,5R,6S,12S)-9,9-dimethyl-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate.
| Compound Name | ethyl (1R,4S,5R,6S,12S)-9,9-dimethyl-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate |
|---|---|
| PubChem CID | 162411362 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | ethyl (1R,4S,5R,6S,12S)-9,9-dimethyl-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.3.1.04,12]dodec-7-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)O[C@@H]3CCC(C)(C)C(=C[C@@H]1[Si](C)(C)C)[C@H]23 |
| InChI | InChI=1S/C19H30O4Si/c1-7-22-17(20)15-13(24(4,5)6)10-11-14-12(8-9-19(11,2)3)23-18(21)16(14)15/h10,12-16H,7-9H2,1-6H3/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | ALOJGFXFMNFZCG-CWVYHPPDSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|