C16H24O4Si — CID 162411364
ethyl (1R,4R,9S,10S,11S)-2-oxo-9-trimethylsilyl-3-oxatricyclo[5.3.1.04,11]undec-7-ene-10-carboxylate (PubChem CID 162411364) has the molecular formula C16H24O4Si and a molecular weight of 308.45 g/mol. Its IUPAC name is ethyl (1R,4R,9S,10S,11S)-2-oxo-9-trimethylsilyl-3-oxatricyclo[5.3.1.04,11]undec-7-ene-10-carboxylate.
| Compound Name | ethyl (1R,4R,9S,10S,11S)-2-oxo-9-trimethylsilyl-3-oxatricyclo[5.3.1.04,11]undec-7-ene-10-carboxylate |
|---|---|
| PubChem CID | 162411364 |
| Molecular Formula | C16H24O4Si |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl (1R,4R,9S,10S,11S)-2-oxo-9-trimethylsilyl-3-oxatricyclo[5.3.1.04,11]undec-7-ene-10-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C(=O)O[C@@H]3CCC(=C[C@@H]1[Si](C)(C)C)[C@H]23 |
| InChI | InChI=1S/C16H24O4Si/c1-5-19-15(17)13-11(21(2,3)4)8-9-6-7-10-12(9)14(13)16(18)20-10/h8,10-14H,5-7H2,1-4H3/t10-,11+,12+,13+,14-/m1/s1 |
| InChIKey | LZLFIIMONJIWJK-IKOXMDCHSA-N |
| XLogP | 2.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|