C25H27ClN2O2 — CID 162411373
(6aS,11bS)-3-(3-chloropropyl)-7-[(4-methoxyphenyl)methyl]-1,2,6,6a-tetrahydropyrrolo[2,3-d]carbazol-5-one (PubChem CID 162411373) has the molecular formula C25H27ClN2O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is (6aS,11bS)-3-(3-chloropropyl)-7-[(4-methoxyphenyl)methyl]-1,2,6,6a-tetrahydropyrrolo[2,3-d]carbazol-5-one.
| Compound Name | (6aS,11bS)-3-(3-chloropropyl)-7-[(4-methoxyphenyl)methyl]-1,2,6,6a-tetrahydropyrrolo[2,3-d]carbazol-5-one |
|---|---|
| PubChem CID | 162411373 |
| Molecular Formula | C25H27ClN2O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (6aS,11bS)-3-(3-chloropropyl)-7-[(4-methoxyphenyl)methyl]-1,2,6,6a-tetrahydropyrrolo[2,3-d]carbazol-5-one |
| SMILES | COc1ccc(CN2c3ccccc3[C@]34CCN(CCCCl)C3=CC(=O)C[C@H]24)cc1 |
| InChI | InChI=1S/C25H27ClN2O2/c1-30-20-9-7-18(8-10-20)17-28-22-6-3-2-5-21(22)25-11-14-27(13-4-12-26)23(25)15-19(29)16-24(25)28/h2-3,5-10,15,24H,4,11-14,16-17H2,1H3/t24-,25+/m0/s1 |
| InChIKey | PLHGPHKYLCHLCA-LOSJGSFVSA-N |
| XLogP | 4.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|